C20H38O3Si2 — CID 16755809
(2R,3R)-1-[tert-butyl(dimethyl)silyl]oxy-3-ethynyl-6-triethylsilylhex-5-yne-2,3-diol (PubChem CID 16755809) has the molecular formula C20H38O3Si2 and a molecular weight of 382.69 g/mol. Its IUPAC name is (2R,3R)-1-[tert-butyl(dimethyl)silyl]oxy-3-ethynyl-6-triethylsilylhex-5-yne-2,3-diol.
| Compound Name | (2R,3R)-1-[tert-butyl(dimethyl)silyl]oxy-3-ethynyl-6-triethylsilylhex-5-yne-2,3-diol |
|---|---|
| PubChem CID | 16755809 |
| Molecular Formula | C20H38O3Si2 |
| Molecular Weight | 382.69 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | (2R,3R)-1-[tert-butyl(dimethyl)silyl]oxy-3-ethynyl-6-triethylsilylhex-5-yne-2,3-diol |
| SMILES | C#C[C@](O)(CC#C[Si](CC)(CC)CC)[C@H](O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H38O3Si2/c1-10-20(22,15-14-16-25(11-2,12-3)13-4)18(21)17-23-24(8,9)19(5,6)7/h1,18,21-22H,11-13,15,17H2,2-9H3/t18-,20+/m1/s1 |
| InChIKey | QTULWSRJELFCHE-QUCCMNQESA-N |
| XLogP | 4.17 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.69 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|