C29H46N4O7 — CID 16756000
tert-butyl N-[(3S,13S,16S,17R,19S)-18,18-dimethyl-2,15-dioxo-13-[2-oxo-2-(prop-2-enylamino)acetyl]-5-oxa-1,14-diazatricyclo[14.4.0.017,19]icosan-3-yl]carbamate (PubChem CID 16756000) has the molecular formula C29H46N4O7 and a molecular weight of 562.71 g/mol. Its IUPAC name is tert-butyl N-[(3S,13S,16S,17R,19S)-18,18-dimethyl-2,15-dioxo-13-[2-oxo-2-(prop-2-enylamino)acetyl]-5-oxa-1,14-diazatricyclo[14.4.0.017,19]icosan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,13S,16S,17R,19S)-18,18-dimethyl-2,15-dioxo-13-[2-oxo-2-(prop-2-enylamino)acetyl]-5-oxa-1,14-diazatricyclo[14.4.0.017,19]icosan-3-yl]carbamate |
|---|---|
| PubChem CID | 16756000 |
| Molecular Formula | C29H46N4O7 |
| Molecular Weight | 562.71 g/mol |
| Exact Mass | 562.34 |
| IUPAC Name | tert-butyl N-[(3S,13S,16S,17R,19S)-18,18-dimethyl-2,15-dioxo-13-[2-oxo-2-(prop-2-enylamino)acetyl]-5-oxa-1,14-diazatricyclo[14.4.0.017,19]icosan-3-yl]carbamate |
| SMILES | C=CCNC(=O)C(=O)[C@@H]1CCCCCCCOC[C@H](NC(=O)OC(C)(C)C)C(=O)N2C[C@H]3[C@@H]([C@H]2C(=O)N1)C3(C)C |
| InChI | InChI=1S/C29H46N4O7/c1-7-14-30-25(36)23(34)19-13-11-9-8-10-12-15-39-17-20(32-27(38)40-28(2,3)4)26(37)33-16-18-21(29(18,5)6)22(33)24(35)31-19/h7,18-22H,1,8-17H2,2-6H3,(H,30,36)(H,31,35)(H,32,38)/t18-,19-,20-,21-,22-/m0/s1 |
| InChIKey | ZHURZEVUEVEVIK-YFNVTMOMSA-N |
| XLogP | 2.09 |
| TPSA | 143.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.71 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|