About ethane;1-hydroxy-2,4-dimethylpyridin-1-ium;propane
ethane;1-hydroxy-2,4-dimethylpyridin-1-ium;propane (PubChem CID 167560316) has the molecular formula C12H24NO+
and a molecular weight of 198.33 g/mol. Its IUPAC name is ethane;1-hydroxy-2,4-dimethylpyridin-1-ium;propane.
Molecular Properties
| Compound Name | ethane;1-hydroxy-2,4-dimethylpyridin-1-ium;propane |
| PubChem CID | 167560316 |
| Molecular Formula | C12H24NO+ |
| Molecular Weight | 198.33 g/mol |
| Exact Mass | 198.19 |
| IUPAC Name | ethane;1-hydroxy-2,4-dimethylpyridin-1-ium;propane |
| SMILES | CC.CCC.Cc1cc[n+](O)c(C)c1 |
| InChI | InChI=1S/C7H10NO.C3H8.C2H6/c1-6-3-4-8(9)7(2)5-6;1-3-2;1-2/h3-5,9H,1-2H3;3H2,1-2H3;1-2H3/q+1;; |
| InChIKey | DOMABOBXMNEQAW-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 24.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.33 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-hydroxy-2,4-dimethylpyridin-1-ium;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-hydroxy-2,4-dimethylpyridin-1-ium;propane?
The IUPAC name of ethane;1-hydroxy-2,4-dimethylpyridin-1-ium;propane (CID 167560316) is ethane;1-hydroxy-2,4-dimethylpyridin-1-ium;propane.
What is the SMILES notation for ethane;1-hydroxy-2,4-dimethylpyridin-1-ium;propane?
The canonical SMILES for ethane;1-hydroxy-2,4-dimethylpyridin-1-ium;propane is CC.CCC.Cc1cc[n+](O)c(C)c1.
What is the InChIKey of ethane;1-hydroxy-2,4-dimethylpyridin-1-ium;propane?
The InChIKey is DOMABOBXMNEQAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10NO.C3H8.C2H6/c1-6-3-4-8(9)7(2)5-6;1-3-2;1-2/h3-5,9H,1-2H3;3H2,1-2H3;1-2H3/q+1;;.
What are the key properties of ethane;1-hydroxy-2,4-dimethylpyridin-1-ium;propane?
ethane;1-hydroxy-2,4-dimethylpyridin-1-ium;propane has a molecular weight of 198.33 g/mol, XLogP of 3.27, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-hydroxy-2,4-dimethylpyridin-1-ium;propane is sourced from PubChem (CID 167560316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).