C31H37ClFN5O — CID 167560391
4-(3-azabicyclo[3.2.1]octan-3-yl)-7-(3-chloro-2-propan-2-ylphenyl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidine (PubChem CID 167560391) has the molecular formula C31H37ClFN5O and a molecular weight of 550.12 g/mol. Its IUPAC name is 4-(3-azabicyclo[3.2.1]octan-3-yl)-7-(3-chloro-2-propan-2-ylphenyl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidine.
| Compound Name | 4-(3-azabicyclo[3.2.1]octan-3-yl)-7-(3-chloro-2-propan-2-ylphenyl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 167560391 |
| Molecular Formula | C31H37ClFN5O |
| Molecular Weight | 550.12 g/mol |
| Exact Mass | 549.27 |
| IUPAC Name | 4-(3-azabicyclo[3.2.1]octan-3-yl)-7-(3-chloro-2-propan-2-ylphenyl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidine |
| SMILES | CC(C)c1c(Cl)cccc1-c1ncc2c(N3CC4CCC(C4)C3)nc(OCC34CCCN3CCC4)nc2c1F |
| InChI | InChI=1S/C31H37ClFN5O/c1-19(2)25-22(6-3-7-24(25)32)27-26(33)28-23(15-34-27)29(37-16-20-8-9-21(14-20)17-37)36-30(35-28)39-18-31-10-4-12-38(31)13-5-11-31/h3,6-7,15,19-21H,4-5,8-14,16-18H2,1-2H3 |
| InChIKey | DORLIFZXPUBDMF-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 54.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.12 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |