C16H22N4S — CID 167560482
4-[(3R)-3-(isocyanomethyl)piperidin-1-yl]-2-methylsulfanyl-5,6,7,8-tetrahydroquinazoline (PubChem CID 167560482) has the molecular formula C16H22N4S and a molecular weight of 302.45 g/mol. Its IUPAC name is 4-[(3R)-3-(isocyanomethyl)piperidin-1-yl]-2-methylsulfanyl-5,6,7,8-tetrahydroquinazoline.
| Compound Name | 4-[(3R)-3-(isocyanomethyl)piperidin-1-yl]-2-methylsulfanyl-5,6,7,8-tetrahydroquinazoline |
|---|---|
| PubChem CID | 167560482 |
| Molecular Formula | C16H22N4S |
| Molecular Weight | 302.45 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 4-[(3R)-3-(isocyanomethyl)piperidin-1-yl]-2-methylsulfanyl-5,6,7,8-tetrahydroquinazoline |
| SMILES | [C-]#[N+]C[C@@H]1CCCN(c2nc(SC)nc3c2CCCC3)C1 |
| InChI | InChI=1S/C16H22N4S/c1-17-10-12-6-5-9-20(11-12)15-13-7-3-4-8-14(13)18-16(19-15)21-2/h12H,3-11H2,2H3/t12-/m0/s1 |
| InChIKey | DPAHVAVUEQLHGQ-LBPRGKRZSA-N |
| XLogP | 3.21 |
| TPSA | 33.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.45 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|