C29H28N2O — CID 167561104
1-(2,3-diphenylquinolin-6-yl)-3-(1-methylpyrrolidin-3-yl)propan-2-one (PubChem CID 167561104) has the molecular formula C29H28N2O and a molecular weight of 420.56 g/mol. Its IUPAC name is 1-(2,3-diphenylquinolin-6-yl)-3-(1-methylpyrrolidin-3-yl)propan-2-one.
| Compound Name | 1-(2,3-diphenylquinolin-6-yl)-3-(1-methylpyrrolidin-3-yl)propan-2-one |
|---|---|
| PubChem CID | 167561104 |
| Molecular Formula | C29H28N2O |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | 1-(2,3-diphenylquinolin-6-yl)-3-(1-methylpyrrolidin-3-yl)propan-2-one |
| SMILES | CN1CCC(CC(=O)Cc2ccc3nc(-c4ccccc4)c(-c4ccccc4)cc3c2)C1 |
| InChI | InChI=1S/C29H28N2O/c1-31-15-14-22(20-31)18-26(32)17-21-12-13-28-25(16-21)19-27(23-8-4-2-5-9-23)29(30-28)24-10-6-3-7-11-24/h2-13,16,19,22H,14-15,17-18,20H2,1H3 |
| InChIKey | DRANAMNZVYIHFI-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |