C16H16N4S — CID 16756167
5-benzylsulfanyl-1-methyl-N-phenyl-1,2,4-triazol-3-amine (PubChem CID 16756167) has the molecular formula C16H16N4S and a molecular weight of 296.40 g/mol. Its IUPAC name is 5-benzylsulfanyl-1-methyl-N-phenyl-1,2,4-triazol-3-amine.
| Compound Name | 5-benzylsulfanyl-1-methyl-N-phenyl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 16756167 |
| Molecular Formula | C16H16N4S |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 5-benzylsulfanyl-1-methyl-N-phenyl-1,2,4-triazol-3-amine |
| SMILES | Cn1nc(Nc2ccccc2)nc1SCc1ccccc1 |
| InChI | InChI=1S/C16H16N4S/c1-20-16(21-12-13-8-4-2-5-9-13)18-15(19-20)17-14-10-6-3-7-11-14/h2-11H,12H2,1H3,(H,17,19) |
| InChIKey | OAFYBXKKDDWUNS-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.40 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |