About (3R,5S)-1-(3-methoxycyclobutyl)-3,5-dimethylpiperidine
(3R,5S)-1-(3-methoxycyclobutyl)-3,5-dimethylpiperidine (PubChem CID 167562526) has the molecular formula C12H23NO
and a molecular weight of 197.32 g/mol. Its IUPAC name is (3R,5S)-1-(3-methoxycyclobutyl)-3,5-dimethylpiperidine.
Molecular Properties
| Compound Name | (3R,5S)-1-(3-methoxycyclobutyl)-3,5-dimethylpiperidine |
| PubChem CID | 167562526 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | (3R,5S)-1-(3-methoxycyclobutyl)-3,5-dimethylpiperidine |
| SMILES | COC1CC(N2C[C@H](C)C[C@H](C)C2)C1 |
| InChI | InChI=1S/C12H23NO/c1-9-4-10(2)8-13(7-9)11-5-12(6-11)14-3/h9-12H,4-8H2,1-3H3/t9-,10+,11?,12? |
| InChIKey | FQJJADZLDFTZCR-ZYANWLCNSA-N |
| XLogP | 2.14 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R,5S)-1-(3-methoxycyclobutyl)-3,5-dimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,5S)-1-(3-methoxycyclobutyl)-3,5-dimethylpiperidine?
The IUPAC name of (3R,5S)-1-(3-methoxycyclobutyl)-3,5-dimethylpiperidine (CID 167562526) is (3R,5S)-1-(3-methoxycyclobutyl)-3,5-dimethylpiperidine.
What is the SMILES notation for (3R,5S)-1-(3-methoxycyclobutyl)-3,5-dimethylpiperidine?
The canonical SMILES for (3R,5S)-1-(3-methoxycyclobutyl)-3,5-dimethylpiperidine is COC1CC(N2C[C@H](C)C[C@H](C)C2)C1.
What is the InChIKey of (3R,5S)-1-(3-methoxycyclobutyl)-3,5-dimethylpiperidine?
The InChIKey is FQJJADZLDFTZCR-ZYANWLCNSA-N. The full InChI is InChI=1S/C12H23NO/c1-9-4-10(2)8-13(7-9)11-5-12(6-11)14-3/h9-12H,4-8H2,1-3H3/t9-,10+,11?,12?.
What are the key properties of (3R,5S)-1-(3-methoxycyclobutyl)-3,5-dimethylpiperidine?
(3R,5S)-1-(3-methoxycyclobutyl)-3,5-dimethylpiperidine has a molecular weight of 197.32 g/mol, XLogP of 2.14, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,5S)-1-(3-methoxycyclobutyl)-3,5-dimethylpiperidine is sourced from PubChem (CID 167562526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).