About 3-cyclopropyloxy-1,5-dimethylpyrazole
3-cyclopropyloxy-1,5-dimethylpyrazole (PubChem CID 167562867) has the molecular formula C8H12N2O
and a molecular weight of 152.20 g/mol. Its IUPAC name is 3-cyclopropyloxy-1,5-dimethylpyrazole.
Molecular Properties
| Compound Name | 3-cyclopropyloxy-1,5-dimethylpyrazole |
| PubChem CID | 167562867 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | 3-cyclopropyloxy-1,5-dimethylpyrazole |
| SMILES | Cc1cc(OC2CC2)nn1C |
| InChI | InChI=1S/C8H12N2O/c1-6-5-8(9-10(6)2)11-7-3-4-7/h5,7H,3-4H2,1-2H3 |
| InChIKey | DWXDSKBPKKAHQZ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-cyclopropyloxy-1,5-dimethylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopropyloxy-1,5-dimethylpyrazole?
The IUPAC name of 3-cyclopropyloxy-1,5-dimethylpyrazole (CID 167562867) is 3-cyclopropyloxy-1,5-dimethylpyrazole.
What is the SMILES notation for 3-cyclopropyloxy-1,5-dimethylpyrazole?
The canonical SMILES for 3-cyclopropyloxy-1,5-dimethylpyrazole is Cc1cc(OC2CC2)nn1C.
What is the InChIKey of 3-cyclopropyloxy-1,5-dimethylpyrazole?
The InChIKey is DWXDSKBPKKAHQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O/c1-6-5-8(9-10(6)2)11-7-3-4-7/h5,7H,3-4H2,1-2H3.
What are the key properties of 3-cyclopropyloxy-1,5-dimethylpyrazole?
3-cyclopropyloxy-1,5-dimethylpyrazole has a molecular weight of 152.20 g/mol, XLogP of 1.27, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopropyloxy-1,5-dimethylpyrazole is sourced from PubChem (CID 167562867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).