C21H36N6O — CID 167562973
2-[(2S)-pentan-2-yl]oxy-7-[(1-pentylpiperidin-4-yl)methyl]imidazo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 167562973) has the molecular formula C21H36N6O and a molecular weight of 388.56 g/mol. Its IUPAC name is 2-[(2S)-pentan-2-yl]oxy-7-[(1-pentylpiperidin-4-yl)methyl]imidazo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 2-[(2S)-pentan-2-yl]oxy-7-[(1-pentylpiperidin-4-yl)methyl]imidazo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 167562973 |
| Molecular Formula | C21H36N6O |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.30 |
| IUPAC Name | 2-[(2S)-pentan-2-yl]oxy-7-[(1-pentylpiperidin-4-yl)methyl]imidazo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | CCCCCN1CCC(Cc2cnc3c(N)nc(O[C@@H](C)CCC)nn23)CC1 |
| InChI | InChI=1S/C21H36N6O/c1-4-6-7-11-26-12-9-17(10-13-26)14-18-15-23-20-19(22)24-21(25-27(18)20)28-16(3)8-5-2/h15-17H,4-14H2,1-3H3,(H2,22,24,25)/t16-/m0/s1 |
| InChIKey | GVIIHPPOLDYUQQ-INIZCTEOSA-N |
| XLogP | 3.72 |
| TPSA | 81.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|