C30H35ClFN5O — CID 167563193
4-(3-azabicyclo[3.2.1]octan-3-yl)-7-(3-chloro-2-ethylphenyl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidine (PubChem CID 167563193) has the molecular formula C30H35ClFN5O and a molecular weight of 536.10 g/mol. Its IUPAC name is 4-(3-azabicyclo[3.2.1]octan-3-yl)-7-(3-chloro-2-ethylphenyl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidine.
| Compound Name | 4-(3-azabicyclo[3.2.1]octan-3-yl)-7-(3-chloro-2-ethylphenyl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 167563193 |
| Molecular Formula | C30H35ClFN5O |
| Molecular Weight | 536.10 g/mol |
| Exact Mass | 535.25 |
| IUPAC Name | 4-(3-azabicyclo[3.2.1]octan-3-yl)-7-(3-chloro-2-ethylphenyl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidine |
| SMILES | CCc1c(Cl)cccc1-c1ncc2c(N3CC4CCC(C4)C3)nc(OCC34CCCN3CCC4)nc2c1F |
| InChI | InChI=1S/C30H35ClFN5O/c1-2-21-22(6-3-7-24(21)31)26-25(32)27-23(15-33-26)28(36-16-19-8-9-20(14-19)17-36)35-29(34-27)38-18-30-10-4-12-37(30)13-5-11-30/h3,6-7,15,19-20H,2,4-5,8-14,16-18H2,1H3 |
| InChIKey | FNHQIDQODGHCAO-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 54.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.10 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |