About N-[3-[1-[4-(3,4-dimethylphenyl)-4-oxobutyl]piperidin-4-yl]phenyl]acetamide
N-[3-[1-[4-(3,4-dimethylphenyl)-4-oxobutyl]piperidin-4-yl]phenyl]acetamide (PubChem CID 16756405) has the molecular formula C25H32N2O2
and a molecular weight of 392.54 g/mol. Its IUPAC name is N-[3-[1-[4-(3,4-dimethylphenyl)-4-oxobutyl]piperidin-4-yl]phenyl]acetamide.
Molecular Properties
| Compound Name | N-[3-[1-[4-(3,4-dimethylphenyl)-4-oxobutyl]piperidin-4-yl]phenyl]acetamide |
| PubChem CID | 16756405 |
| Molecular Formula | C25H32N2O2 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.25 |
| IUPAC Name | N-[3-[1-[4-(3,4-dimethylphenyl)-4-oxobutyl]piperidin-4-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(C2CCN(CCCC(=O)c3ccc(C)c(C)c3)CC2)c1 |
| InChI | InChI=1S/C25H32N2O2/c1-18-9-10-23(16-19(18)2)25(29)8-5-13-27-14-11-21(12-15-27)22-6-4-7-24(17-22)26-20(3)28/h4,6-7,9-10,16-17,21H,5,8,11-15H2,1-3H3,(H,26,28) |
| InChIKey | ZGGXNCTZASWEAU-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[3-[1-[4-(3,4-dimethylphenyl)-4-oxobutyl]piperidin-4-yl]phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[1-[4-(3,4-dimethylphenyl)-4-oxobutyl]piperidin-4-yl]phenyl]acetamide?
The IUPAC name of N-[3-[1-[4-(3,4-dimethylphenyl)-4-oxobutyl]piperidin-4-yl]phenyl]acetamide (CID 16756405) is N-[3-[1-[4-(3,4-dimethylphenyl)-4-oxobutyl]piperidin-4-yl]phenyl]acetamide.
What is the SMILES notation for N-[3-[1-[4-(3,4-dimethylphenyl)-4-oxobutyl]piperidin-4-yl]phenyl]acetamide?
The canonical SMILES for N-[3-[1-[4-(3,4-dimethylphenyl)-4-oxobutyl]piperidin-4-yl]phenyl]acetamide is CC(=O)Nc1cccc(C2CCN(CCCC(=O)c3ccc(C)c(C)c3)CC2)c1.
What is the InChIKey of N-[3-[1-[4-(3,4-dimethylphenyl)-4-oxobutyl]piperidin-4-yl]phenyl]acetamide?
The InChIKey is ZGGXNCTZASWEAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H32N2O2/c1-18-9-10-23(16-19(18)2)25(29)8-5-13-27-14-11-21(12-15-27)22-6-4-7-24(17-22)26-20(3)28/h4,6-7,9-10,16-17,21H,5,8,11-15H2,1-3H3,(H,26,28).
What are the key properties of N-[3-[1-[4-(3,4-dimethylphenyl)-4-oxobutyl]piperidin-4-yl]phenyl]acetamide?
N-[3-[1-[4-(3,4-dimethylphenyl)-4-oxobutyl]piperidin-4-yl]phenyl]acetamide has a molecular weight of 392.54 g/mol, XLogP of 5.10, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[1-[4-(3,4-dimethylphenyl)-4-oxobutyl]piperidin-4-yl]phenyl]acetamide is sourced from PubChem (CID 16756405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).