About (5-amino-2-morpholin-4-ylphenyl)methyl formate;methyl 5-amino-2-fluorobenzoate;morpholine
(5-amino-2-morpholin-4-ylphenyl)methyl formate;methyl 5-amino-2-fluorobenzoate;morpholine (PubChem CID 167564461) has the molecular formula C24H33FN4O6
and a molecular weight of 492.55 g/mol. Its IUPAC name is (5-amino-2-morpholin-4-ylphenyl)methyl formate;methyl 5-amino-2-fluorobenzoate;morpholine.
Molecular Properties
| Compound Name | (5-amino-2-morpholin-4-ylphenyl)methyl formate;methyl 5-amino-2-fluorobenzoate;morpholine |
| PubChem CID | 167564461 |
| Molecular Formula | C24H33FN4O6 |
| Molecular Weight | 492.55 g/mol |
| Exact Mass | 492.24 |
| IUPAC Name | (5-amino-2-morpholin-4-ylphenyl)methyl formate;methyl 5-amino-2-fluorobenzoate;morpholine |
| SMILES | C1COCCN1.COC(=O)c1cc(N)ccc1F.Nc1ccc(N2CCOCC2)c(COC=O)c1 |
| InChI | InChI=1S/C12H16N2O3.C8H8FNO2.C4H9NO/c13-11-1-2-12(10(7-11)8-17-9-15)14-3-5-16-6-4-14;1-12-8(11)6-4-5(10)2-3-7(6)9;1-3-6-4-2-5-1/h1-2,7,9H,3-6,8,13H2;2-4H,10H2,1H3;5H,1-4H2 |
| InChIKey | FCDYZTXENKLCCM-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 138.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 492.55 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (5-amino-2-morpholin-4-ylphenyl)methyl formate;methyl 5-amino-2-fluorobenzoate;morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-amino-2-morpholin-4-ylphenyl)methyl formate;methyl 5-amino-2-fluorobenzoate;morpholine?
The IUPAC name of (5-amino-2-morpholin-4-ylphenyl)methyl formate;methyl 5-amino-2-fluorobenzoate;morpholine (CID 167564461) is (5-amino-2-morpholin-4-ylphenyl)methyl formate;methyl 5-amino-2-fluorobenzoate;morpholine.
What is the SMILES notation for (5-amino-2-morpholin-4-ylphenyl)methyl formate;methyl 5-amino-2-fluorobenzoate;morpholine?
The canonical SMILES for (5-amino-2-morpholin-4-ylphenyl)methyl formate;methyl 5-amino-2-fluorobenzoate;morpholine is C1COCCN1.COC(=O)c1cc(N)ccc1F.Nc1ccc(N2CCOCC2)c(COC=O)c1.
What is the InChIKey of (5-amino-2-morpholin-4-ylphenyl)methyl formate;methyl 5-amino-2-fluorobenzoate;morpholine?
The InChIKey is FCDYZTXENKLCCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O3.C8H8FNO2.C4H9NO/c13-11-1-2-12(10(7-11)8-17-9-15)14-3-5-16-6-4-14;1-12-8(11)6-4-5(10)2-3-7(6)9;1-3-6-4-2-5-1/h1-2,7,9H,3-6,8,13H2;2-4H,10H2,1H3;5H,1-4H2.
What are the key properties of (5-amino-2-morpholin-4-ylphenyl)methyl formate;methyl 5-amino-2-fluorobenzoate;morpholine?
(5-amino-2-morpholin-4-ylphenyl)methyl formate;methyl 5-amino-2-fluorobenzoate;morpholine has a molecular weight of 492.55 g/mol, XLogP of 1.58, 5 rotatable bonds, 3 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for (5-amino-2-morpholin-4-ylphenyl)methyl formate;methyl 5-amino-2-fluorobenzoate;morpholine is sourced from PubChem (CID 167564461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).