C35H38O6P2 — CID 16756452
2-[2-[[2-[(6,8-dimethyl-4H-1,3,2-benzodioxaphosphinin-2-yl)oxy]-3,5-dimethylphenyl]methyl]-4,6-dimethylphenoxy]-6,8-dimethyl-4H-1,3,2-benzodioxaphosphinine (PubChem CID 16756452) has the molecular formula C35H38O6P2 and a molecular weight of 616.63 g/mol. Its IUPAC name is 2-[2-[[2-[(6,8-dimethyl-4H-1,3,2-benzodioxaphosphinin-2-yl)oxy]-3,5-dimethylphenyl]methyl]-4,6-dimethylphenoxy]-6,8-dimethyl-4H-1,3,2-benzodioxaphosphinine.
| Compound Name | 2-[2-[[2-[(6,8-dimethyl-4H-1,3,2-benzodioxaphosphinin-2-yl)oxy]-3,5-dimethylphenyl]methyl]-4,6-dimethylphenoxy]-6,8-dimethyl-4H-1,3,2-benzodioxaphosphinine |
|---|---|
| PubChem CID | 16756452 |
| Molecular Formula | C35H38O6P2 |
| Molecular Weight | 616.63 g/mol |
| Exact Mass | 616.21 |
| IUPAC Name | 2-[2-[[2-[(6,8-dimethyl-4H-1,3,2-benzodioxaphosphinin-2-yl)oxy]-3,5-dimethylphenyl]methyl]-4,6-dimethylphenoxy]-6,8-dimethyl-4H-1,3,2-benzodioxaphosphinine |
| SMILES | Cc1cc(C)c2c(c1)COP(Oc1c(C)cc(C)cc1Cc1cc(C)cc(C)c1OP1OCc3cc(C)cc(C)c3O1)O2 |
| InChI | InChI=1S/C35H38O6P2/c1-20-9-24(5)32(38-42-36-18-30-15-22(3)11-26(7)34(30)40-42)28(13-20)17-29-14-21(2)10-25(6)33(29)39-43-37-19-31-16-23(4)12-27(8)35(31)41-43/h9-16H,17-19H2,1-8H3 |
| InChIKey | KMBWXHQTNAMBEQ-UHFFFAOYSA-N |
| XLogP | 10.17 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.63 |
| LogP ≤ 5 | 10.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|