C24H19F4N3O3 — CID 167564879
9-(4-ethynyl-2-fluorophenyl)-7,10-dioxo-6-[[4-(trifluoromethyl)phenyl]methyl]-2,6,9-triazaspiro[4.5]decane-2-carbaldehyde (PubChem CID 167564879) has the molecular formula C24H19F4N3O3 and a molecular weight of 473.43 g/mol. Its IUPAC name is 9-(4-ethynyl-2-fluorophenyl)-7,10-dioxo-6-[[4-(trifluoromethyl)phenyl]methyl]-2,6,9-triazaspiro[4.5]decane-2-carbaldehyde.
| Compound Name | 9-(4-ethynyl-2-fluorophenyl)-7,10-dioxo-6-[[4-(trifluoromethyl)phenyl]methyl]-2,6,9-triazaspiro[4.5]decane-2-carbaldehyde |
|---|---|
| PubChem CID | 167564879 |
| Molecular Formula | C24H19F4N3O3 |
| Molecular Weight | 473.43 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | 9-(4-ethynyl-2-fluorophenyl)-7,10-dioxo-6-[[4-(trifluoromethyl)phenyl]methyl]-2,6,9-triazaspiro[4.5]decane-2-carbaldehyde |
| SMILES | C#Cc1ccc(N2CC(=O)N(Cc3ccc(C(F)(F)F)cc3)C3(CCN(C=O)C3)C2=O)c(F)c1 |
| InChI | InChI=1S/C24H19F4N3O3/c1-2-16-5-8-20(19(25)11-16)30-13-21(33)31(23(22(30)34)9-10-29(14-23)15-32)12-17-3-6-18(7-4-17)24(26,27)28/h1,3-8,11,15H,9-10,12-14H2 |
| InChIKey | FDJAQRMQIJXQIA-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.43 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|