C33H40N2O3 — CID 167564894
2-[(2-tert-butylanilino)methyl]-4-methylphenol;2-[(2-methoxyanilino)methyl]-4-methylphenol (PubChem CID 167564894) has the molecular formula C33H40N2O3 and a molecular weight of 512.69 g/mol. Its IUPAC name is 2-[(2-tert-butylanilino)methyl]-4-methylphenol;2-[(2-methoxyanilino)methyl]-4-methylphenol.
| Compound Name | 2-[(2-tert-butylanilino)methyl]-4-methylphenol;2-[(2-methoxyanilino)methyl]-4-methylphenol |
|---|---|
| PubChem CID | 167564894 |
| Molecular Formula | C33H40N2O3 |
| Molecular Weight | 512.69 g/mol |
| Exact Mass | 512.30 |
| IUPAC Name | 2-[(2-tert-butylanilino)methyl]-4-methylphenol;2-[(2-methoxyanilino)methyl]-4-methylphenol |
| SMILES | COc1ccccc1NCc1cc(C)ccc1O.Cc1ccc(O)c(CNc2ccccc2C(C)(C)C)c1 |
| InChI | InChI=1S/C18H23NO.C15H17NO2/c1-13-9-10-17(20)14(11-13)12-19-16-8-6-5-7-15(16)18(2,3)4;1-11-7-8-14(17)12(9-11)10-16-13-5-3-4-6-15(13)18-2/h5-11,19-20H,12H2,1-4H3;3-9,16-17H,10H2,1-2H3 |
| InChIKey | FDKLQZSQGIAZPG-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 73.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.69 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|