C45H48ClN7O5 — CID 167564912
5-[4-[4-[4-[8-(3-chloro-4-isocyanophenyl)-2,8-diazaspiro[4.5]decan-2-yl]benzoyl]piperazin-1-yl]piperidin-1-yl]-2-(2,4-dioxocyclohexyl)isoindole-1,3-dione (PubChem CID 167564912) has the molecular formula C45H48ClN7O5 and a molecular weight of 802.38 g/mol. Its IUPAC name is 5-[4-[4-[4-[8-(3-chloro-4-isocyanophenyl)-2,8-diazaspiro[4.5]decan-2-yl]benzoyl]piperazin-1-yl]piperidin-1-yl]-2-(2,4-dioxocyclohexyl)isoindole-1,3-dione.
| Compound Name | 5-[4-[4-[4-[8-(3-chloro-4-isocyanophenyl)-2,8-diazaspiro[4.5]decan-2-yl]benzoyl]piperazin-1-yl]piperidin-1-yl]-2-(2,4-dioxocyclohexyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 167564912 |
| Molecular Formula | C45H48ClN7O5 |
| Molecular Weight | 802.38 g/mol |
| Exact Mass | 801.34 |
| IUPAC Name | 5-[4-[4-[4-[8-(3-chloro-4-isocyanophenyl)-2,8-diazaspiro[4.5]decan-2-yl]benzoyl]piperazin-1-yl]piperidin-1-yl]-2-(2,4-dioxocyclohexyl)isoindole-1,3-dione |
| SMILES | [C-]#[N+]c1ccc(N2CCC3(CC2)CCN(c2ccc(C(=O)N4CCN(C5CCN(c6ccc7c(c6)C(=O)N(C6CCC(=O)CC6=O)C7=O)CC5)CC4)cc2)C3)cc1Cl |
| InChI | InChI=1S/C45H48ClN7O5/c1-47-39-10-7-34(27-38(39)46)49-19-14-45(15-20-49)16-21-52(29-45)31-4-2-30(3-5-31)42(56)51-24-22-50(23-25-51)32-12-17-48(18-13-32)33-6-9-36-37(26-33)44(58)53(43(36)57)40-11-8-35(54)28-41(40)55/h2-7,9-10,26-27,32,40H,8,11-25,28-29H2 |
| InChIKey | FDLLZKJDGWHDCN-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 109.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.38 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|