About ethane;1-ethyl-3-(oxan-4-yl)-3,4-dihydro-1H-isochromene-5,6-diol
ethane;1-ethyl-3-(oxan-4-yl)-3,4-dihydro-1H-isochromene-5,6-diol (PubChem CID 167565257) has the molecular formula C18H28O4
and a molecular weight of 308.42 g/mol. Its IUPAC name is ethane;1-ethyl-3-(oxan-4-yl)-3,4-dihydro-1H-isochromene-5,6-diol.
Molecular Properties
| Compound Name | ethane;1-ethyl-3-(oxan-4-yl)-3,4-dihydro-1H-isochromene-5,6-diol |
| PubChem CID | 167565257 |
| Molecular Formula | C18H28O4 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | ethane;1-ethyl-3-(oxan-4-yl)-3,4-dihydro-1H-isochromene-5,6-diol |
| SMILES | CC.CCC1OC(C2CCOCC2)Cc2c1ccc(O)c2O |
| InChI | InChI=1S/C16H22O4.C2H6/c1-2-14-11-3-4-13(17)16(18)12(11)9-15(20-14)10-5-7-19-8-6-10;1-2/h3-4,10,14-15,17-18H,2,5-9H2,1H3;1-2H3 |
| InChIKey | FETFVGNLFOVDOE-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-ethyl-3-(oxan-4-yl)-3,4-dihydro-1H-isochromene-5,6-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-ethyl-3-(oxan-4-yl)-3,4-dihydro-1H-isochromene-5,6-diol?
The IUPAC name of ethane;1-ethyl-3-(oxan-4-yl)-3,4-dihydro-1H-isochromene-5,6-diol (CID 167565257) is ethane;1-ethyl-3-(oxan-4-yl)-3,4-dihydro-1H-isochromene-5,6-diol.
What is the SMILES notation for ethane;1-ethyl-3-(oxan-4-yl)-3,4-dihydro-1H-isochromene-5,6-diol?
The canonical SMILES for ethane;1-ethyl-3-(oxan-4-yl)-3,4-dihydro-1H-isochromene-5,6-diol is CC.CCC1OC(C2CCOCC2)Cc2c1ccc(O)c2O.
What is the InChIKey of ethane;1-ethyl-3-(oxan-4-yl)-3,4-dihydro-1H-isochromene-5,6-diol?
The InChIKey is FETFVGNLFOVDOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22O4.C2H6/c1-2-14-11-3-4-13(17)16(18)12(11)9-15(20-14)10-5-7-19-8-6-10;1-2/h3-4,10,14-15,17-18H,2,5-9H2,1H3;1-2H3.
What are the key properties of ethane;1-ethyl-3-(oxan-4-yl)-3,4-dihydro-1H-isochromene-5,6-diol?
ethane;1-ethyl-3-(oxan-4-yl)-3,4-dihydro-1H-isochromene-5,6-diol has a molecular weight of 308.42 g/mol, XLogP of 3.94, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-ethyl-3-(oxan-4-yl)-3,4-dihydro-1H-isochromene-5,6-diol is sourced from PubChem (CID 167565257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).