C29H41N3O4 — CID 167569895
(2S,5S,8S)-5-(7,7-dimethyl-6-oxooctyl)-14-methoxy-2-(2-methylpropyl)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione (PubChem CID 167569895) has the molecular formula C29H41N3O4 and a molecular weight of 495.66 g/mol. Its IUPAC name is (2S,5S,8S)-5-(7,7-dimethyl-6-oxooctyl)-14-methoxy-2-(2-methylpropyl)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione.
| Compound Name | (2S,5S,8S)-5-(7,7-dimethyl-6-oxooctyl)-14-methoxy-2-(2-methylpropyl)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
|---|---|
| PubChem CID | 167569895 |
| Molecular Formula | C29H41N3O4 |
| Molecular Weight | 495.66 g/mol |
| Exact Mass | 495.31 |
| IUPAC Name | (2S,5S,8S)-5-(7,7-dimethyl-6-oxooctyl)-14-methoxy-2-(2-methylpropyl)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
| SMILES | COc1ccc2c3c([nH]c2c1)[C@H](CC(C)C)N1C(=O)[C@H](CCCCCC(=O)C(C)(C)C)NC(=O)[C@@H]1C3 |
| InChI | InChI=1S/C29H41N3O4/c1-17(2)14-23-26-20(19-13-12-18(36-6)15-22(19)30-26)16-24-27(34)31-21(28(35)32(23)24)10-8-7-9-11-25(33)29(3,4)5/h12-13,15,17,21,23-24,30H,7-11,14,16H2,1-6H3,(H,31,34)/t21-,23-,24-/m0/s1 |
| InChIKey | FTPCXUZHHLSYPR-XWGVYQGASA-N |
| XLogP | 5.08 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.66 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|