C32H47NO8 — CID 16757024
N-[(3,5-dimethoxyphenyl)methyl]-1-[(12E)-2,5,8,17,20,23-hexaoxabicyclo[22.4.0]octacosa-1(24),12,25,27-tetraen-26-yl]methanamine (PubChem CID 16757024) has the molecular formula C32H47NO8 and a molecular weight of 573.73 g/mol. Its IUPAC name is N-[(3,5-dimethoxyphenyl)methyl]-1-[(12E)-2,5,8,17,20,23-hexaoxabicyclo[22.4.0]octacosa-1(24),12,25,27-tetraen-26-yl]methanamine.
| Compound Name | N-[(3,5-dimethoxyphenyl)methyl]-1-[(12E)-2,5,8,17,20,23-hexaoxabicyclo[22.4.0]octacosa-1(24),12,25,27-tetraen-26-yl]methanamine |
|---|---|
| PubChem CID | 16757024 |
| Molecular Formula | C32H47NO8 |
| Molecular Weight | 573.73 g/mol |
| Exact Mass | 573.33 |
| IUPAC Name | N-[(3,5-dimethoxyphenyl)methyl]-1-[(12E)-2,5,8,17,20,23-hexaoxabicyclo[22.4.0]octacosa-1(24),12,25,27-tetraen-26-yl]methanamine |
| SMILES | COc1cc(CNCc2ccc3c(c2)OCCOCCOCCC/C=C/CCCOCCOCCO3)cc(OC)c1 |
| InChI | InChI=1S/C32H47NO8/c1-34-29-21-28(22-30(24-29)35-2)26-33-25-27-9-10-31-32(23-27)41-20-18-39-16-14-37-12-8-6-4-3-5-7-11-36-13-15-38-17-19-40-31/h3-4,9-10,21-24,33H,5-8,11-20,25-26H2,1-2H3/b4-3+ |
| InChIKey | DPEDGMILSAJRJT-ONEGZZNKSA-N |
| XLogP | 4.95 |
| TPSA | 85.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.73 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|