C28H47Br — CID 167570513
(3S,10R,13R,17R)-7-bromo-3,10,13-trimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 167570513) has the molecular formula C28H47Br and a molecular weight of 463.59 g/mol. Its IUPAC name is (3S,10R,13R,17R)-7-bromo-3,10,13-trimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (3S,10R,13R,17R)-7-bromo-3,10,13-trimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 167570513 |
| Molecular Formula | C28H47Br |
| Molecular Weight | 463.59 g/mol |
| Exact Mass | 462.29 |
| IUPAC Name | (3S,10R,13R,17R)-7-bromo-3,10,13-trimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CCC2C3C(Br)C=C4C[C@@H](C)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C28H47Br/c1-18(2)8-7-9-20(4)22-10-11-23-26-24(13-15-28(22,23)6)27(5)14-12-19(3)16-21(27)17-25(26)29/h17-20,22-26H,7-16H2,1-6H3/t19-,20+,22+,23?,24?,25?,26?,27-,28+/m0/s1 |
| InChIKey | LDCAURRYALCELW-WGQBUEBLSA-N |
| XLogP | 9.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.59 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|