C19H17F5N6O3 — CID 167571249
(4R,5R,6S)-4-(6-amino-3-fluoro-2-pyridinyl)-5-fluoro-4-methyl-6-(trifluoromethyl)-5,6-dihydro-1,3-oxazin-2-amine;5-cyano-3-methylpyridine-2-carboxylic acid (PubChem CID 167571249) has the molecular formula C19H17F5N6O3 and a molecular weight of 472.37 g/mol. Its IUPAC name is (4R,5R,6S)-4-(6-amino-3-fluoro-2-pyridinyl)-5-fluoro-4-methyl-6-(trifluoromethyl)-5,6-dihydro-1,3-oxazin-2-amine;5-cyano-3-methylpyridine-2-carboxylic acid.
| Compound Name | (4R,5R,6S)-4-(6-amino-3-fluoro-2-pyridinyl)-5-fluoro-4-methyl-6-(trifluoromethyl)-5,6-dihydro-1,3-oxazin-2-amine;5-cyano-3-methylpyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 167571249 |
| Molecular Formula | C19H17F5N6O3 |
| Molecular Weight | 472.37 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | (4R,5R,6S)-4-(6-amino-3-fluoro-2-pyridinyl)-5-fluoro-4-methyl-6-(trifluoromethyl)-5,6-dihydro-1,3-oxazin-2-amine;5-cyano-3-methylpyridine-2-carboxylic acid |
| SMILES | C[C@]1(c2nc(N)ccc2F)N=C(N)O[C@H](C(F)(F)F)[C@@H]1F.Cc1cc(C#N)cnc1C(=O)O |
| InChI | InChI=1S/C11H11F5N4O.C8H6N2O2/c1-10(7-4(12)2-3-5(17)19-7)6(13)8(11(14,15)16)21-9(18)20-10;1-5-2-6(3-9)4-10-7(5)8(11)12/h2-3,6,8H,1H3,(H2,17,19)(H2,18,20);2,4H,1H3,(H,11,12)/t6-,8-,10-;/m0./s1 |
| InChIKey | FXYCABZIOKENMV-PXXMOAEPSA-N |
| XLogP | 2.59 |
| TPSA | 160.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.37 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |