C33H47N3O5Si — CID 167572058
prop-2-enyl N-[2-[(2R)-2-ethyl-4-(6-methoxy-3-pyridinyl)-2,3-dihydropyrrole-1-carbonyl]-4-methyl-5-tri(propan-2-yl)silyloxyphenyl]carbamate (PubChem CID 167572058) has the molecular formula C33H47N3O5Si and a molecular weight of 593.84 g/mol. Its IUPAC name is prop-2-enyl N-[2-[(2R)-2-ethyl-4-(6-methoxy-3-pyridinyl)-2,3-dihydropyrrole-1-carbonyl]-4-methyl-5-tri(propan-2-yl)silyloxyphenyl]carbamate.
| Compound Name | prop-2-enyl N-[2-[(2R)-2-ethyl-4-(6-methoxy-3-pyridinyl)-2,3-dihydropyrrole-1-carbonyl]-4-methyl-5-tri(propan-2-yl)silyloxyphenyl]carbamate |
|---|---|
| PubChem CID | 167572058 |
| Molecular Formula | C33H47N3O5Si |
| Molecular Weight | 593.84 g/mol |
| Exact Mass | 593.33 |
| IUPAC Name | prop-2-enyl N-[2-[(2R)-2-ethyl-4-(6-methoxy-3-pyridinyl)-2,3-dihydropyrrole-1-carbonyl]-4-methyl-5-tri(propan-2-yl)silyloxyphenyl]carbamate |
| SMILES | C=CCOC(=O)Nc1cc(O[Si](C(C)C)(C(C)C)C(C)C)c(C)cc1C(=O)N1C=C(c2ccc(OC)nc2)C[C@H]1CC |
| InChI | InChI=1S/C33H47N3O5Si/c1-11-15-40-33(38)35-29-18-30(41-42(21(3)4,22(5)6)23(7)8)24(9)16-28(29)32(37)36-20-26(17-27(36)12-2)25-13-14-31(39-10)34-19-25/h11,13-14,16,18-23,27H,1,12,15,17H2,2-10H3,(H,35,38)/t27-/m1/s1 |
| InChIKey | SKAYPVVIPXQTTE-HHHXNRCGSA-N |
| XLogP | 8.35 |
| TPSA | 89.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.84 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|