C25H34O2SSi — CID 16757213
S-ethyl (E,5S)-6-[tert-butyl(diphenyl)silyl]oxy-5-methylhex-2-enethioate (PubChem CID 16757213) has the molecular formula C25H34O2SSi and a molecular weight of 426.70 g/mol. Its IUPAC name is S-ethyl (E,5S)-6-[tert-butyl(diphenyl)silyl]oxy-5-methylhex-2-enethioate.
| Compound Name | S-ethyl (E,5S)-6-[tert-butyl(diphenyl)silyl]oxy-5-methylhex-2-enethioate |
|---|---|
| PubChem CID | 16757213 |
| Molecular Formula | C25H34O2SSi |
| Molecular Weight | 426.70 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | S-ethyl (E,5S)-6-[tert-butyl(diphenyl)silyl]oxy-5-methylhex-2-enethioate |
| SMILES | CCSC(=O)/C=C/C[C@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C25H34O2SSi/c1-6-28-24(26)19-13-14-21(2)20-27-29(25(3,4)5,22-15-9-7-10-16-22)23-17-11-8-12-18-23/h7-13,15-19,21H,6,14,20H2,1-5H3/b19-13+/t21-/m0/s1 |
| InChIKey | PBLWVQPOQYCDLU-YMFQVDJJSA-N |
| XLogP | 5.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.70 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|