About S-ethyl (E,5S)-6-[tert-butyl(diphenyl)silyl]oxy-5-methylhex-2-enethioate
S-ethyl (E,5S)-6-[tert-butyl(diphenyl)silyl]oxy-5-methylhex-2-enethioate (PubChem CID 16757213) has the molecular formula C25H34O2SSi
and a molecular weight of 426.70 g/mol. Its IUPAC name is S-ethyl (E,5S)-6-[tert-butyl(diphenyl)silyl]oxy-5-methylhex-2-enethioate.
Molecular Properties
| Compound Name | S-ethyl (E,5S)-6-[tert-butyl(diphenyl)silyl]oxy-5-methylhex-2-enethioate |
| PubChem CID | 16757213 |
| Molecular Formula | C25H34O2SSi |
| Molecular Weight | 426.70 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | S-ethyl (E,5S)-6-[tert-butyl(diphenyl)silyl]oxy-5-methylhex-2-enethioate |
| SMILES | CCSC(=O)/C=C/C[C@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C25H34O2SSi/c1-6-28-24(26)19-13-14-21(2)20-27-29(25(3,4)5,22-15-9-7-10-16-22)23-17-11-8-12-18-23/h7-13,15-19,21H,6,14,20H2,1-5H3/b19-13+/t21-/m0/s1 |
| InChIKey | PBLWVQPOQYCDLU-YMFQVDJJSA-N |
| XLogP | 5.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.70 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-ethyl (E,5S)-6-[tert-butyl(diphenyl)silyl]oxy-5-methylhex-2-enethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-ethyl (E,5S)-6-[tert-butyl(diphenyl)silyl]oxy-5-methylhex-2-enethioate?
The IUPAC name of S-ethyl (E,5S)-6-[tert-butyl(diphenyl)silyl]oxy-5-methylhex-2-enethioate (CID 16757213) is S-ethyl (E,5S)-6-[tert-butyl(diphenyl)silyl]oxy-5-methylhex-2-enethioate.
What is the SMILES notation for S-ethyl (E,5S)-6-[tert-butyl(diphenyl)silyl]oxy-5-methylhex-2-enethioate?
The canonical SMILES for S-ethyl (E,5S)-6-[tert-butyl(diphenyl)silyl]oxy-5-methylhex-2-enethioate is CCSC(=O)/C=C/C[C@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C.
What is the InChIKey of S-ethyl (E,5S)-6-[tert-butyl(diphenyl)silyl]oxy-5-methylhex-2-enethioate?
The InChIKey is PBLWVQPOQYCDLU-YMFQVDJJSA-N. The full InChI is InChI=1S/C25H34O2SSi/c1-6-28-24(26)19-13-14-21(2)20-27-29(25(3,4)5,22-15-9-7-10-16-22)23-17-11-8-12-18-23/h7-13,15-19,21H,6,14,20H2,1-5H3/b19-13+/t21-/m0/s1.
What are the key properties of S-ethyl (E,5S)-6-[tert-butyl(diphenyl)silyl]oxy-5-methylhex-2-enethioate?
S-ethyl (E,5S)-6-[tert-butyl(diphenyl)silyl]oxy-5-methylhex-2-enethioate has a molecular weight of 426.70 g/mol, XLogP of 5.43, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-ethyl (E,5S)-6-[tert-butyl(diphenyl)silyl]oxy-5-methylhex-2-enethioate is sourced from PubChem (CID 16757213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).