C21H25FN4O2 — CID 16757245
tert-butyl (1R,2R,4S)-2-[6-amino-5-(6-fluoro-3-pyridinyl)-3-pyridinyl]-7-azabicyclo[2.2.1]heptane-7-carboxylate (PubChem CID 16757245) has the molecular formula C21H25FN4O2 and a molecular weight of 384.46 g/mol. Its IUPAC name is tert-butyl (1R,2R,4S)-2-[6-amino-5-(6-fluoro-3-pyridinyl)-3-pyridinyl]-7-azabicyclo[2.2.1]heptane-7-carboxylate.
| Compound Name | tert-butyl (1R,2R,4S)-2-[6-amino-5-(6-fluoro-3-pyridinyl)-3-pyridinyl]-7-azabicyclo[2.2.1]heptane-7-carboxylate |
|---|---|
| PubChem CID | 16757245 |
| Molecular Formula | C21H25FN4O2 |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | tert-butyl (1R,2R,4S)-2-[6-amino-5-(6-fluoro-3-pyridinyl)-3-pyridinyl]-7-azabicyclo[2.2.1]heptane-7-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@H]2CC[C@@H]1[C@@H](c1cnc(N)c(-c3ccc(F)nc3)c1)C2 |
| InChI | InChI=1S/C21H25FN4O2/c1-21(2,3)28-20(27)26-14-5-6-17(26)15(9-14)13-8-16(19(23)25-11-13)12-4-7-18(22)24-10-12/h4,7-8,10-11,14-15,17H,5-6,9H2,1-3H3,(H2,23,25)/t14-,15+,17+/m0/s1 |
| InChIKey | YDAIPQGRKUKASM-ZMSDIMECSA-N |
| XLogP | 4.12 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|