C36H43N5O3 — CID 167572638
4-[2-[2-[4-(4-hydroxycyclohexyl)-3-oxobutyl]-5-methyl-3,4-dihydro-1H-isoquinolin-7-yl]-5H-pyrrolo[2,3-b]pyrazin-7-yl]-N,N,2-trimethylbenzamide (PubChem CID 167572638) has the molecular formula C36H43N5O3 and a molecular weight of 593.77 g/mol. Its IUPAC name is 4-[2-[2-[4-(4-hydroxycyclohexyl)-3-oxobutyl]-5-methyl-3,4-dihydro-1H-isoquinolin-7-yl]-5H-pyrrolo[2,3-b]pyrazin-7-yl]-N,N,2-trimethylbenzamide.
| Compound Name | 4-[2-[2-[4-(4-hydroxycyclohexyl)-3-oxobutyl]-5-methyl-3,4-dihydro-1H-isoquinolin-7-yl]-5H-pyrrolo[2,3-b]pyrazin-7-yl]-N,N,2-trimethylbenzamide |
|---|---|
| PubChem CID | 167572638 |
| Molecular Formula | C36H43N5O3 |
| Molecular Weight | 593.77 g/mol |
| Exact Mass | 593.34 |
| IUPAC Name | 4-[2-[2-[4-(4-hydroxycyclohexyl)-3-oxobutyl]-5-methyl-3,4-dihydro-1H-isoquinolin-7-yl]-5H-pyrrolo[2,3-b]pyrazin-7-yl]-N,N,2-trimethylbenzamide |
| SMILES | Cc1cc(-c2c[nH]c3ncc(-c4cc(C)c5c(c4)CN(CCC(=O)CC4CCC(O)CC4)CC5)nc23)ccc1C(=O)N(C)C |
| InChI | InChI=1S/C36H43N5O3/c1-22-16-26(18-27-21-41(14-12-30(22)27)13-11-29(43)17-24-5-8-28(42)9-6-24)33-20-38-35-34(39-33)32(19-37-35)25-7-10-31(23(2)15-25)36(44)40(3)4/h7,10,15-16,18-20,24,28,42H,5-6,8-9,11-14,17,21H2,1-4H3,(H,37,38) |
| InChIKey | GCLYAXBKWRPDKG-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.77 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |