C24H30N4O4 — CID 167572684
(2E,4E)-2-ethenyl-N-[4-methoxy-7-(1,4-oxazepan-4-yl)-3H-indol-2-yl]-N',N'-dimethylhexa-2,4-dienediamide (PubChem CID 167572684) has the molecular formula C24H30N4O4 and a molecular weight of 438.53 g/mol. Its IUPAC name is (2E,4E)-2-ethenyl-N-[4-methoxy-7-(1,4-oxazepan-4-yl)-3H-indol-2-yl]-N',N'-dimethylhexa-2,4-dienediamide.
| Compound Name | (2E,4E)-2-ethenyl-N-[4-methoxy-7-(1,4-oxazepan-4-yl)-3H-indol-2-yl]-N',N'-dimethylhexa-2,4-dienediamide |
|---|---|
| PubChem CID | 167572684 |
| Molecular Formula | C24H30N4O4 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | (2E,4E)-2-ethenyl-N-[4-methoxy-7-(1,4-oxazepan-4-yl)-3H-indol-2-yl]-N',N'-dimethylhexa-2,4-dienediamide |
| SMILES | C=C/C(=C\C=C\C(=O)N(C)C)C(=O)NC1=Nc2c(N3CCCOCC3)ccc(OC)c2C1 |
| InChI | InChI=1S/C24H30N4O4/c1-5-17(8-6-9-22(29)27(2)3)24(30)26-21-16-18-20(31-4)11-10-19(23(18)25-21)28-12-7-14-32-15-13-28/h5-6,8-11H,1,7,12-16H2,2-4H3,(H,25,26,30)/b9-6+,17-8+ |
| InChIKey | GCRYWRNCCVKMKC-LQWOVWEESA-N |
| XLogP | 2.38 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|