About 8,9-dihydro-7H-cyclopenta[h][1,5]benzodioxepin-3-one
8,9-dihydro-7H-cyclopenta[h][1,5]benzodioxepin-3-one (PubChem CID 16757333) has the molecular formula C12H12O3
and a molecular weight of 204.22 g/mol. Its IUPAC name is 8,9-dihydro-7H-cyclopenta[h][1,5]benzodioxepin-3-one.
Molecular Properties
| Compound Name | 8,9-dihydro-7H-cyclopenta[h][1,5]benzodioxepin-3-one |
| PubChem CID | 16757333 |
| Molecular Formula | C12H12O3 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | 8,9-dihydro-7H-cyclopenta[h][1,5]benzodioxepin-3-one |
| SMILES | O=C1COc2cc3c(cc2OC1)CCC3 |
| InChI | InChI=1S/C12H12O3/c13-10-6-14-11-4-8-2-1-3-9(8)5-12(11)15-7-10/h4-5H,1-3,6-7H2 |
| InChIKey | JTAHMTWJNXDJEG-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8,9-dihydro-7H-cyclopenta[h][1,5]benzodioxepin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8,9-dihydro-7H-cyclopenta[h][1,5]benzodioxepin-3-one?
The IUPAC name of 8,9-dihydro-7H-cyclopenta[h][1,5]benzodioxepin-3-one (CID 16757333) is 8,9-dihydro-7H-cyclopenta[h][1,5]benzodioxepin-3-one.
What is the SMILES notation for 8,9-dihydro-7H-cyclopenta[h][1,5]benzodioxepin-3-one?
The canonical SMILES for 8,9-dihydro-7H-cyclopenta[h][1,5]benzodioxepin-3-one is O=C1COc2cc3c(cc2OC1)CCC3.
What is the InChIKey of 8,9-dihydro-7H-cyclopenta[h][1,5]benzodioxepin-3-one?
The InChIKey is JTAHMTWJNXDJEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O3/c13-10-6-14-11-4-8-2-1-3-9(8)5-12(11)15-7-10/h4-5H,1-3,6-7H2.
What are the key properties of 8,9-dihydro-7H-cyclopenta[h][1,5]benzodioxepin-3-one?
8,9-dihydro-7H-cyclopenta[h][1,5]benzodioxepin-3-one has a molecular weight of 204.22 g/mol, XLogP of 1.52, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8,9-dihydro-7H-cyclopenta[h][1,5]benzodioxepin-3-one is sourced from PubChem (CID 16757333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).