C29H21F4N7O3 — CID 167573514
4-azido-2,3,5,6-tetrafluoro-N-[3-[2-oxo-2-[4-(1-phenylethenyl)piperazin-1-yl]acetyl]-1H-indol-7-yl]benzamide (PubChem CID 167573514) has the molecular formula C29H21F4N7O3 and a molecular weight of 591.53 g/mol. Its IUPAC name is 4-azido-2,3,5,6-tetrafluoro-N-[3-[2-oxo-2-[4-(1-phenylethenyl)piperazin-1-yl]acetyl]-1H-indol-7-yl]benzamide.
| Compound Name | 4-azido-2,3,5,6-tetrafluoro-N-[3-[2-oxo-2-[4-(1-phenylethenyl)piperazin-1-yl]acetyl]-1H-indol-7-yl]benzamide |
|---|---|
| PubChem CID | 167573514 |
| Molecular Formula | C29H21F4N7O3 |
| Molecular Weight | 591.53 g/mol |
| Exact Mass | 591.16 |
| IUPAC Name | 4-azido-2,3,5,6-tetrafluoro-N-[3-[2-oxo-2-[4-(1-phenylethenyl)piperazin-1-yl]acetyl]-1H-indol-7-yl]benzamide |
| SMILES | C=C(c1ccccc1)N1CCN(C(=O)C(=O)c2c[nH]c3c(NC(=O)c4c(F)c(F)c(N=[N+]=[N-])c(F)c4F)cccc23)CC1 |
| InChI | InChI=1S/C29H21F4N7O3/c1-15(16-6-3-2-4-7-16)39-10-12-40(13-11-39)29(43)27(41)18-14-35-25-17(18)8-5-9-19(25)36-28(42)20-21(30)23(32)26(37-38-34)24(33)22(20)31/h2-9,14,35H,1,10-13H2,(H,36,42) |
| InChIKey | HBAUMULHGWOKOV-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.53 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|