C23H26N6O2S — CID 167574373
[(2S)-1-[2-[[5-(3-methoxy-4,5-dimethylphenyl)-1,3-thiazol-2-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-4-yl]pyrrolidin-2-yl]methanol (PubChem CID 167574373) has the molecular formula C23H26N6O2S and a molecular weight of 450.57 g/mol. Its IUPAC name is [(2S)-1-[2-[[5-(3-methoxy-4,5-dimethylphenyl)-1,3-thiazol-2-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-4-yl]pyrrolidin-2-yl]methanol.
| Compound Name | [(2S)-1-[2-[[5-(3-methoxy-4,5-dimethylphenyl)-1,3-thiazol-2-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-4-yl]pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 167574373 |
| Molecular Formula | C23H26N6O2S |
| Molecular Weight | 450.57 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | [(2S)-1-[2-[[5-(3-methoxy-4,5-dimethylphenyl)-1,3-thiazol-2-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-4-yl]pyrrolidin-2-yl]methanol |
| SMILES | COc1cc(-c2cnc(Nc3nc(N4CCC[C@H]4CO)c4cccn4n3)s2)cc(C)c1C |
| InChI | InChI=1S/C23H26N6O2S/c1-14-10-16(11-19(31-3)15(14)2)20-12-24-23(32-20)26-22-25-21(18-7-5-9-29(18)27-22)28-8-4-6-17(28)13-30/h5,7,9-12,17,30H,4,6,8,13H2,1-3H3,(H,24,26,27)/t17-/m0/s1 |
| InChIKey | XVTHISJHFAGNAN-KRWDZBQOSA-N |
| XLogP | 4.18 |
| TPSA | 87.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.57 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |