About 4-(aminomethyl)benzene-1,2-diol;2-(2-aminophenyl)ethanol
4-(aminomethyl)benzene-1,2-diol;2-(2-aminophenyl)ethanol (PubChem CID 167575613) has the molecular formula C15H20N2O3
and a molecular weight of 276.34 g/mol. Its IUPAC name is 4-(aminomethyl)benzene-1,2-diol;2-(2-aminophenyl)ethanol.
Molecular Properties
| Compound Name | 4-(aminomethyl)benzene-1,2-diol;2-(2-aminophenyl)ethanol |
| PubChem CID | 167575613 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 4-(aminomethyl)benzene-1,2-diol;2-(2-aminophenyl)ethanol |
| SMILES | NCc1ccc(O)c(O)c1.Nc1ccccc1CCO |
| InChI | InChI=1S/C8H11NO.C7H9NO2/c9-8-4-2-1-3-7(8)5-6-10;8-4-5-1-2-6(9)7(10)3-5/h1-4,10H,5-6,9H2;1-3,9-10H,4,8H2 |
| InChIKey | GMJHGECJUPBRRE-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 4-(aminomethyl)benzene-1,2-diol;2-(2-aminophenyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(aminomethyl)benzene-1,2-diol;2-(2-aminophenyl)ethanol?
The IUPAC name of 4-(aminomethyl)benzene-1,2-diol;2-(2-aminophenyl)ethanol (CID 167575613) is 4-(aminomethyl)benzene-1,2-diol;2-(2-aminophenyl)ethanol.
What is the SMILES notation for 4-(aminomethyl)benzene-1,2-diol;2-(2-aminophenyl)ethanol?
The canonical SMILES for 4-(aminomethyl)benzene-1,2-diol;2-(2-aminophenyl)ethanol is NCc1ccc(O)c(O)c1.Nc1ccccc1CCO.
What is the InChIKey of 4-(aminomethyl)benzene-1,2-diol;2-(2-aminophenyl)ethanol?
The InChIKey is GMJHGECJUPBRRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO.C7H9NO2/c9-8-4-2-1-3-7(8)5-6-10;8-4-5-1-2-6(9)7(10)3-5/h1-4,10H,5-6,9H2;1-3,9-10H,4,8H2.
What are the key properties of 4-(aminomethyl)benzene-1,2-diol;2-(2-aminophenyl)ethanol?
4-(aminomethyl)benzene-1,2-diol;2-(2-aminophenyl)ethanol has a molecular weight of 276.34 g/mol, XLogP of 1.36, 3 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(aminomethyl)benzene-1,2-diol;2-(2-aminophenyl)ethanol is sourced from PubChem (CID 167575613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).