C36H50N2O10 — CID 167575895
N-methyl-8-oxo-8-[3-[4-[2-oxo-5-[4-[(3S,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxybutanoylamino]pentoxy]phenyl]phenyl]octanamide (PubChem CID 167575895) has the molecular formula C36H50N2O10 and a molecular weight of 670.80 g/mol. Its IUPAC name is N-methyl-8-oxo-8-[3-[4-[2-oxo-5-[4-[(3S,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxybutanoylamino]pentoxy]phenyl]phenyl]octanamide.
| Compound Name | N-methyl-8-oxo-8-[3-[4-[2-oxo-5-[4-[(3S,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxybutanoylamino]pentoxy]phenyl]phenyl]octanamide |
|---|---|
| PubChem CID | 167575895 |
| Molecular Formula | C36H50N2O10 |
| Molecular Weight | 670.80 g/mol |
| Exact Mass | 670.35 |
| IUPAC Name | N-methyl-8-oxo-8-[3-[4-[2-oxo-5-[4-[(3S,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxybutanoylamino]pentoxy]phenyl]phenyl]octanamide |
| SMILES | CNC(=O)CCCCCCC(=O)c1cccc(-c2ccc(OCC(=O)CCCNC(=O)CCCOC3O[C@@H](C)[C@H](O)C(O)[C@@H]3O)cc2)c1 |
| InChI | InChI=1S/C36H50N2O10/c1-24-33(43)34(44)35(45)36(48-24)46-21-9-15-32(42)38-20-8-12-28(39)23-47-29-18-16-25(17-19-29)26-10-7-11-27(22-26)30(40)13-5-3-4-6-14-31(41)37-2/h7,10-11,16-19,22,24,33-36,43-45H,3-6,8-9,12-15,20-21,23H2,1-2H3,(H,37,41)(H,38,42)/t24-,33-,34?,35-,36?/m0/s1 |
| InChIKey | ZIGZIXWMXNAIOQ-QORFMNINSA-N |
| XLogP | 3.09 |
| TPSA | 180.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.80 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|