About 7-fluoro-3,6-dimethyl-2H-indazole
7-fluoro-3,6-dimethyl-2H-indazole (PubChem CID 167575971) has the molecular formula C9H9FN2
and a molecular weight of 164.18 g/mol. Its IUPAC name is 7-fluoro-3,6-dimethyl-2H-indazole.
Molecular Properties
| Compound Name | 7-fluoro-3,6-dimethyl-2H-indazole |
| PubChem CID | 167575971 |
| Molecular Formula | C9H9FN2 |
| Molecular Weight | 164.18 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | 7-fluoro-3,6-dimethyl-2H-indazole |
| SMILES | Cc1ccc2c(C)[nH]nc2c1F |
| InChI | InChI=1S/C9H9FN2/c1-5-3-4-7-6(2)11-12-9(7)8(5)10/h3-4H,1-2H3,(H,11,12) |
| InChIKey | SVRYCCWPXQCHSF-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.18 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-fluoro-3,6-dimethyl-2H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-3,6-dimethyl-2H-indazole?
The IUPAC name of 7-fluoro-3,6-dimethyl-2H-indazole (CID 167575971) is 7-fluoro-3,6-dimethyl-2H-indazole.
What is the SMILES notation for 7-fluoro-3,6-dimethyl-2H-indazole?
The canonical SMILES for 7-fluoro-3,6-dimethyl-2H-indazole is Cc1ccc2c(C)[nH]nc2c1F.
What is the InChIKey of 7-fluoro-3,6-dimethyl-2H-indazole?
The InChIKey is SVRYCCWPXQCHSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9FN2/c1-5-3-4-7-6(2)11-12-9(7)8(5)10/h3-4H,1-2H3,(H,11,12).
What are the key properties of 7-fluoro-3,6-dimethyl-2H-indazole?
7-fluoro-3,6-dimethyl-2H-indazole has a molecular weight of 164.18 g/mol, XLogP of 2.32, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-3,6-dimethyl-2H-indazole is sourced from PubChem (CID 167575971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).