C30H27F2N11O — CID 167578016
N-[6-(2,3-dihydro-1H-inden-4-ylamino)-5-fluoro-2H-pyrazolo[3,4-b]pyridin-3-yl]nitrous amide;6-N-(2,3-dihydro-1H-inden-4-yl)-5-fluoro-2H-pyrazolo[3,4-b]pyridine-3,6-diamine (PubChem CID 167578016) has the molecular formula C30H27F2N11O and a molecular weight of 595.62 g/mol. Its IUPAC name is N-[6-(2,3-dihydro-1H-inden-4-ylamino)-5-fluoro-2H-pyrazolo[3,4-b]pyridin-3-yl]nitrous amide;6-N-(2,3-dihydro-1H-inden-4-yl)-5-fluoro-2H-pyrazolo[3,4-b]pyridine-3,6-diamine.
| Compound Name | N-[6-(2,3-dihydro-1H-inden-4-ylamino)-5-fluoro-2H-pyrazolo[3,4-b]pyridin-3-yl]nitrous amide;6-N-(2,3-dihydro-1H-inden-4-yl)-5-fluoro-2H-pyrazolo[3,4-b]pyridine-3,6-diamine |
|---|---|
| PubChem CID | 167578016 |
| Molecular Formula | C30H27F2N11O |
| Molecular Weight | 595.62 g/mol |
| Exact Mass | 595.24 |
| IUPAC Name | N-[6-(2,3-dihydro-1H-inden-4-ylamino)-5-fluoro-2H-pyrazolo[3,4-b]pyridin-3-yl]nitrous amide;6-N-(2,3-dihydro-1H-inden-4-yl)-5-fluoro-2H-pyrazolo[3,4-b]pyridine-3,6-diamine |
| SMILES | Nc1[nH]nc2nc(Nc3cccc4c3CCC4)c(F)cc12.O=NNc1[nH]nc2nc(Nc3cccc4c3CCC4)c(F)cc12 |
| InChI | InChI=1S/C15H13FN6O.C15H14FN5/c16-11-7-10-13(19-20-14(10)21-22-23)18-15(11)17-12-6-2-4-8-3-1-5-9(8)12;16-11-7-10-13(17)20-21-14(10)19-15(11)18-12-6-2-4-8-3-1-5-9(8)12/h2,4,6-7H,1,3,5H2,(H3,17,18,19,20,21,23);2,4,6-7H,1,3,5H2,(H4,17,18,19,20,21) |
| InChIKey | GUGZXPKYLIIGRD-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 174.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.62 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|