C32H36N8O3S — CID 167578919
N-(2,6-dimethylphenyl)-4-[2-(ethenylsulfonylamino)anilino]-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidine-5-carboxamide (PubChem CID 167578919) has the molecular formula C32H36N8O3S and a molecular weight of 612.76 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-4-[2-(ethenylsulfonylamino)anilino]-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidine-5-carboxamide.
| Compound Name | N-(2,6-dimethylphenyl)-4-[2-(ethenylsulfonylamino)anilino]-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 167578919 |
| Molecular Formula | C32H36N8O3S |
| Molecular Weight | 612.76 g/mol |
| Exact Mass | 612.26 |
| IUPAC Name | N-(2,6-dimethylphenyl)-4-[2-(ethenylsulfonylamino)anilino]-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidine-5-carboxamide |
| SMILES | C=CS(=O)(=O)Nc1ccccc1Nc1nc(Nc2ccc(N3CCN(C)CC3)cc2)ncc1C(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/C32H36N8O3S/c1-5-44(42,43)38-28-12-7-6-11-27(28)35-30-26(31(41)36-29-22(2)9-8-10-23(29)3)21-33-32(37-30)34-24-13-15-25(16-14-24)40-19-17-39(4)18-20-40/h5-16,21,38H,1,17-20H2,2-4H3,(H,36,41)(H2,33,34,35,37) |
| InChIKey | LLOPVMKXHHJFCF-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 131.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.76 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|