C28H40F2O8 — CID 167581976
10,10-difluoro-11-[2-hydroxy-3-(4-methoxyphenoxy)propoxy]-1-[4-(hydroxymethyl)phenyl]undecane-1,6,6-triol (PubChem CID 167581976) has the molecular formula C28H40F2O8 and a molecular weight of 542.62 g/mol. Its IUPAC name is 10,10-difluoro-11-[2-hydroxy-3-(4-methoxyphenoxy)propoxy]-1-[4-(hydroxymethyl)phenyl]undecane-1,6,6-triol.
| Compound Name | 10,10-difluoro-11-[2-hydroxy-3-(4-methoxyphenoxy)propoxy]-1-[4-(hydroxymethyl)phenyl]undecane-1,6,6-triol |
|---|---|
| PubChem CID | 167581976 |
| Molecular Formula | C28H40F2O8 |
| Molecular Weight | 542.62 g/mol |
| Exact Mass | 542.27 |
| IUPAC Name | 10,10-difluoro-11-[2-hydroxy-3-(4-methoxyphenoxy)propoxy]-1-[4-(hydroxymethyl)phenyl]undecane-1,6,6-triol |
| SMILES | COc1ccc(OCC(O)COCC(F)(F)CCCC(O)(O)CCCCC(O)c2ccc(CO)cc2)cc1 |
| InChI | InChI=1S/C28H40F2O8/c1-36-24-10-12-25(13-11-24)38-19-23(32)18-37-20-27(29,30)14-4-16-28(34,35)15-3-2-5-26(33)22-8-6-21(17-31)7-9-22/h6-13,23,26,31-35H,2-5,14-20H2,1H3 |
| InChIKey | HHGCHOLZAOYCCM-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 128.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.62 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|