C17H27N3O — CID 16758242
N-[(2S)-1-(2,3-dimethyl-6,7,8,9-tetrahydropyrido[3,2-b]azepin-5-yl)propan-2-yl]oxypropan-2-imine (PubChem CID 16758242) has the molecular formula C17H27N3O and a molecular weight of 289.42 g/mol. Its IUPAC name is N-[(2S)-1-(2,3-dimethyl-6,7,8,9-tetrahydropyrido[3,2-b]azepin-5-yl)propan-2-yl]oxypropan-2-imine.
| Compound Name | N-[(2S)-1-(2,3-dimethyl-6,7,8,9-tetrahydropyrido[3,2-b]azepin-5-yl)propan-2-yl]oxypropan-2-imine |
|---|---|
| PubChem CID | 16758242 |
| Molecular Formula | C17H27N3O |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.22 |
| IUPAC Name | N-[(2S)-1-(2,3-dimethyl-6,7,8,9-tetrahydropyrido[3,2-b]azepin-5-yl)propan-2-yl]oxypropan-2-imine |
| SMILES | CC(C)=NO[C@@H](C)CN1CCCCc2nc(C)c(C)cc21 |
| InChI | InChI=1S/C17H27N3O/c1-12(2)19-21-14(4)11-20-9-7-6-8-16-17(20)10-13(3)15(5)18-16/h10,14H,6-9,11H2,1-5H3/t14-/m0/s1 |
| InChIKey | IFFKGACIWGLILD-AWEZNQCLSA-N |
| XLogP | 3.64 |
| TPSA | 37.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|