C21H33NO7 — CID 16758247
(3S,7Z,9R,10R,15Z,17R,18S)-9,18-dimethoxy-3,10,17-trimethyl-1,12-dioxa-4-azacyclononadeca-7,15-diene-2,5,13-trione (PubChem CID 16758247) has the molecular formula C21H33NO7 and a molecular weight of 411.50 g/mol. Its IUPAC name is (3S,7Z,9R,10R,15Z,17R,18S)-9,18-dimethoxy-3,10,17-trimethyl-1,12-dioxa-4-azacyclononadeca-7,15-diene-2,5,13-trione.
| Compound Name | (3S,7Z,9R,10R,15Z,17R,18S)-9,18-dimethoxy-3,10,17-trimethyl-1,12-dioxa-4-azacyclononadeca-7,15-diene-2,5,13-trione |
|---|---|
| PubChem CID | 16758247 |
| Molecular Formula | C21H33NO7 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | (3S,7Z,9R,10R,15Z,17R,18S)-9,18-dimethoxy-3,10,17-trimethyl-1,12-dioxa-4-azacyclononadeca-7,15-diene-2,5,13-trione |
| SMILES | CO[C@@H]1/C=C\CC(=O)N[C@@H](C)C(=O)OC[C@@H](OC)[C@H](C)/C=C\CC(=O)OC[C@H]1C |
| InChI | InChI=1S/C21H33NO7/c1-14-8-6-11-20(24)28-12-15(2)17(26-4)9-7-10-19(23)22-16(3)21(25)29-13-18(14)27-5/h6-9,14-18H,10-13H2,1-5H3,(H,22,23)/b8-6-,9-7-/t14-,15-,16+,17-,18-/m1/s1 |
| InChIKey | JAZUWPIUMSOILL-DSZTUSQQSA-N |
| XLogP | 1.79 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|