C21H30O7 — CID 16758252
(1R,6Z,8R,9S,14Z,16R,17S,20R)-20-hydroxy-9-methoxy-8,16-dimethyl-3,11,21-trioxabicyclo[15.3.1]henicosa-6,14,18-triene-4,12-dione (PubChem CID 16758252) has the molecular formula C21H30O7 and a molecular weight of 394.46 g/mol. Its IUPAC name is (1R,6Z,8R,9S,14Z,16R,17S,20R)-20-hydroxy-9-methoxy-8,16-dimethyl-3,11,21-trioxabicyclo[15.3.1]henicosa-6,14,18-triene-4,12-dione.
| Compound Name | (1R,6Z,8R,9S,14Z,16R,17S,20R)-20-hydroxy-9-methoxy-8,16-dimethyl-3,11,21-trioxabicyclo[15.3.1]henicosa-6,14,18-triene-4,12-dione |
|---|---|
| PubChem CID | 16758252 |
| Molecular Formula | C21H30O7 |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | (1R,6Z,8R,9S,14Z,16R,17S,20R)-20-hydroxy-9-methoxy-8,16-dimethyl-3,11,21-trioxabicyclo[15.3.1]henicosa-6,14,18-triene-4,12-dione |
| SMILES | CO[C@@H]1COC(=O)C/C=C\[C@@H](C)[C@@H]2C=C[C@@H](O)[C@@H](COC(=O)C/C=C\[C@H]1C)O2 |
| InChI | InChI=1S/C21H30O7/c1-14-6-4-8-20(23)26-12-18(25-3)15(2)7-5-9-21(24)27-13-19-16(22)10-11-17(14)28-19/h4-7,10-11,14-19,22H,8-9,12-13H2,1-3H3/b6-4-,7-5-/t14-,15-,16-,17+,18-,19-/m1/s1 |
| InChIKey | MSXOTBYEAAYXMV-ACVHAELFSA-N |
| XLogP | 1.95 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|