C20H25NO5 — CID 16758266
(3S,6S,11Z,13R)-3-benzyl-6,13-dimethyl-1,8-dioxa-4-azacyclotetradec-11-ene-2,5,9-trione (PubChem CID 16758266) has the molecular formula C20H25NO5 and a molecular weight of 359.42 g/mol. Its IUPAC name is (3S,6S,11Z,13R)-3-benzyl-6,13-dimethyl-1,8-dioxa-4-azacyclotetradec-11-ene-2,5,9-trione.
| Compound Name | (3S,6S,11Z,13R)-3-benzyl-6,13-dimethyl-1,8-dioxa-4-azacyclotetradec-11-ene-2,5,9-trione |
|---|---|
| PubChem CID | 16758266 |
| Molecular Formula | C20H25NO5 |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | (3S,6S,11Z,13R)-3-benzyl-6,13-dimethyl-1,8-dioxa-4-azacyclotetradec-11-ene-2,5,9-trione |
| SMILES | C[C@@H]1/C=C\CC(=O)OC[C@H](C)C(=O)N[C@@H](Cc2ccccc2)C(=O)OC1 |
| InChI | InChI=1S/C20H25NO5/c1-14-7-6-10-18(22)25-13-15(2)19(23)21-17(20(24)26-12-14)11-16-8-4-3-5-9-16/h3-9,14-15,17H,10-13H2,1-2H3,(H,21,23)/b7-6-/t14-,15+,17+/m1/s1 |
| InChIKey | QOJPJAVHKPIYBD-DGCBXJPOSA-N |
| XLogP | 2.03 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|