C16H25NO6 — CID 16758268
(3S,7Z,9R,10R,14S)-10-methoxy-3,9,14-trimethyl-1,12-dioxa-4-azacyclopentadec-7-ene-2,5,13-trione (PubChem CID 16758268) has the molecular formula C16H25NO6 and a molecular weight of 327.38 g/mol. Its IUPAC name is (3S,7Z,9R,10R,14S)-10-methoxy-3,9,14-trimethyl-1,12-dioxa-4-azacyclopentadec-7-ene-2,5,13-trione.
| Compound Name | (3S,7Z,9R,10R,14S)-10-methoxy-3,9,14-trimethyl-1,12-dioxa-4-azacyclopentadec-7-ene-2,5,13-trione |
|---|---|
| PubChem CID | 16758268 |
| Molecular Formula | C16H25NO6 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | (3S,7Z,9R,10R,14S)-10-methoxy-3,9,14-trimethyl-1,12-dioxa-4-azacyclopentadec-7-ene-2,5,13-trione |
| SMILES | CO[C@H]1COC(=O)[C@@H](C)COC(=O)[C@H](C)NC(=O)C/C=C\[C@H]1C |
| InChI | InChI=1S/C16H25NO6/c1-10-6-5-7-14(18)17-12(3)16(20)22-8-11(2)15(19)23-9-13(10)21-4/h5-6,10-13H,7-9H2,1-4H3,(H,17,18)/b6-5-/t10-,11+,12+,13+/m1/s1 |
| InChIKey | AHIWJYKDBBBJDM-XRCCKWKSSA-N |
| XLogP | 0.82 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|