C24H38N2O7S — CID 16758275
(3R,7Z,9R,13S,17Z,19R,20S)-20-methoxy-9,13,19-trimethyl-3-(2-methylsulfanylethyl)-1,11-dioxa-4,14-diazacyclohenicosa-7,17-diene-2,5,12,15-tetrone (PubChem CID 16758275) has the molecular formula C24H38N2O7S and a molecular weight of 498.64 g/mol. Its IUPAC name is (3R,7Z,9R,13S,17Z,19R,20S)-20-methoxy-9,13,19-trimethyl-3-(2-methylsulfanylethyl)-1,11-dioxa-4,14-diazacyclohenicosa-7,17-diene-2,5,12,15-tetrone.
| Compound Name | (3R,7Z,9R,13S,17Z,19R,20S)-20-methoxy-9,13,19-trimethyl-3-(2-methylsulfanylethyl)-1,11-dioxa-4,14-diazacyclohenicosa-7,17-diene-2,5,12,15-tetrone |
|---|---|
| PubChem CID | 16758275 |
| Molecular Formula | C24H38N2O7S |
| Molecular Weight | 498.64 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | (3R,7Z,9R,13S,17Z,19R,20S)-20-methoxy-9,13,19-trimethyl-3-(2-methylsulfanylethyl)-1,11-dioxa-4,14-diazacyclohenicosa-7,17-diene-2,5,12,15-tetrone |
| SMILES | CO[C@@H]1COC(=O)[C@@H](CCSC)NC(=O)C/C=C\[C@@H](C)COC(=O)[C@H](C)NC(=O)C/C=C\[C@H]1C |
| InChI | InChI=1S/C24H38N2O7S/c1-16-8-6-10-22(28)26-19(12-13-34-5)24(30)33-15-20(31-4)17(2)9-7-11-21(27)25-18(3)23(29)32-14-16/h6-9,16-20H,10-15H2,1-5H3,(H,25,27)(H,26,28)/b8-6-,9-7-/t16-,17-,18+,19-,20-/m1/s1 |
| InChIKey | WDHLGTXJXNVQOL-AEYOOFOCSA-N |
| XLogP | 2.01 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.64 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|