C22H34O8 — CID 16758290
(3R,8Z,10S,11R,16Z,18S,19R)-11,19-dimethoxy-3,10,18-trimethyl-1,5,13-trioxacycloicosa-8,16-diene-2,6,14-trione (PubChem CID 16758290) has the molecular formula C22H34O8 and a molecular weight of 426.51 g/mol. Its IUPAC name is (3R,8Z,10S,11R,16Z,18S,19R)-11,19-dimethoxy-3,10,18-trimethyl-1,5,13-trioxacycloicosa-8,16-diene-2,6,14-trione.
| Compound Name | (3R,8Z,10S,11R,16Z,18S,19R)-11,19-dimethoxy-3,10,18-trimethyl-1,5,13-trioxacycloicosa-8,16-diene-2,6,14-trione |
|---|---|
| PubChem CID | 16758290 |
| Molecular Formula | C22H34O8 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | (3R,8Z,10S,11R,16Z,18S,19R)-11,19-dimethoxy-3,10,18-trimethyl-1,5,13-trioxacycloicosa-8,16-diene-2,6,14-trione |
| SMILES | CO[C@H]1COC(=O)C/C=C\[C@H](C)[C@@H](OC)COC(=O)[C@H](C)COC(=O)C/C=C\[C@@H]1C |
| InChI | InChI=1S/C22H34O8/c1-15-8-6-10-20(23)28-12-17(3)22(25)30-14-19(27-5)16(2)9-7-11-21(24)29-13-18(15)26-4/h6-9,15-19H,10-14H2,1-5H3/b8-6-,9-7-/t15-,16-,17+,18-,19-/m0/s1 |
| InChIKey | KBHPPKYRDDJVFM-CYJLBHOESA-N |
| XLogP | 2.46 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|