C24H38N2O8 — CID 16758304
(3S,7Z,9R,10S,14S,18Z,20R,21S)-10,21-dimethoxy-3,9,14,20-tetramethyl-1,12-dioxa-4,15-diazacyclodocosa-7,18-diene-2,5,13,16-tetrone (PubChem CID 16758304) has the molecular formula C24H38N2O8 and a molecular weight of 482.57 g/mol. Its IUPAC name is (3S,7Z,9R,10S,14S,18Z,20R,21S)-10,21-dimethoxy-3,9,14,20-tetramethyl-1,12-dioxa-4,15-diazacyclodocosa-7,18-diene-2,5,13,16-tetrone.
| Compound Name | (3S,7Z,9R,10S,14S,18Z,20R,21S)-10,21-dimethoxy-3,9,14,20-tetramethyl-1,12-dioxa-4,15-diazacyclodocosa-7,18-diene-2,5,13,16-tetrone |
|---|---|
| PubChem CID | 16758304 |
| Molecular Formula | C24H38N2O8 |
| Molecular Weight | 482.57 g/mol |
| Exact Mass | 482.26 |
| IUPAC Name | (3S,7Z,9R,10S,14S,18Z,20R,21S)-10,21-dimethoxy-3,9,14,20-tetramethyl-1,12-dioxa-4,15-diazacyclodocosa-7,18-diene-2,5,13,16-tetrone |
| SMILES | CO[C@@H]1COC(=O)[C@H](C)NC(=O)C/C=C\[C@@H](C)[C@H](OC)COC(=O)[C@H](C)NC(=O)C/C=C\[C@H]1C |
| InChI | InChI=1S/C24H38N2O8/c1-15-9-7-11-21(27)25-18(4)24(30)34-14-20(32-6)16(2)10-8-12-22(28)26-17(3)23(29)33-13-19(15)31-5/h7-10,15-20H,11-14H2,1-6H3,(H,25,27)(H,26,28)/b9-7-,10-8-/t15-,16-,17+,18+,19-,20-/m1/s1 |
| InChIKey | UXFGDHMMNCODGO-IYLFNAGXSA-N |
| XLogP | 1.29 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.57 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|