About methyl (2S)-2-[[(Z,5R)-6-hydroxy-5-methylhex-3-enoyl]amino]propanoate
methyl (2S)-2-[[(Z,5R)-6-hydroxy-5-methylhex-3-enoyl]amino]propanoate (PubChem CID 16758352) has the molecular formula C11H19NO4
and a molecular weight of 229.28 g/mol. Its IUPAC name is methyl (2S)-2-[[(Z,5R)-6-hydroxy-5-methylhex-3-enoyl]amino]propanoate.
Molecular Properties
| Compound Name | methyl (2S)-2-[[(Z,5R)-6-hydroxy-5-methylhex-3-enoyl]amino]propanoate |
| PubChem CID | 16758352 |
| Molecular Formula | C11H19NO4 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | methyl (2S)-2-[[(Z,5R)-6-hydroxy-5-methylhex-3-enoyl]amino]propanoate |
| SMILES | COC(=O)[C@H](C)NC(=O)C/C=C\[C@@H](C)CO |
| InChI | InChI=1S/C11H19NO4/c1-8(7-13)5-4-6-10(14)12-9(2)11(15)16-3/h4-5,8-9,13H,6-7H2,1-3H3,(H,12,14)/b5-4-/t8-,9+/m1/s1 |
| InChIKey | GKFXDYKSKBKXTA-KHTCFXRASA-N |
| XLogP | 0.24 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl (2S)-2-[[(Z,5R)-6-hydroxy-5-methylhex-3-enoyl]amino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S)-2-[[(Z,5R)-6-hydroxy-5-methylhex-3-enoyl]amino]propanoate?
The IUPAC name of methyl (2S)-2-[[(Z,5R)-6-hydroxy-5-methylhex-3-enoyl]amino]propanoate (CID 16758352) is methyl (2S)-2-[[(Z,5R)-6-hydroxy-5-methylhex-3-enoyl]amino]propanoate.
What is the SMILES notation for methyl (2S)-2-[[(Z,5R)-6-hydroxy-5-methylhex-3-enoyl]amino]propanoate?
The canonical SMILES for methyl (2S)-2-[[(Z,5R)-6-hydroxy-5-methylhex-3-enoyl]amino]propanoate is COC(=O)[C@H](C)NC(=O)C/C=C\[C@@H](C)CO.
What is the InChIKey of methyl (2S)-2-[[(Z,5R)-6-hydroxy-5-methylhex-3-enoyl]amino]propanoate?
The InChIKey is GKFXDYKSKBKXTA-KHTCFXRASA-N. The full InChI is InChI=1S/C11H19NO4/c1-8(7-13)5-4-6-10(14)12-9(2)11(15)16-3/h4-5,8-9,13H,6-7H2,1-3H3,(H,12,14)/b5-4-/t8-,9+/m1/s1.
What are the key properties of methyl (2S)-2-[[(Z,5R)-6-hydroxy-5-methylhex-3-enoyl]amino]propanoate?
methyl (2S)-2-[[(Z,5R)-6-hydroxy-5-methylhex-3-enoyl]amino]propanoate has a molecular weight of 229.28 g/mol, XLogP of 0.24, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-2-[[(Z,5R)-6-hydroxy-5-methylhex-3-enoyl]amino]propanoate is sourced from PubChem (CID 16758352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).