C13H20O5 — CID 16758353
methyl (Z,5R)-5-[(2R,3S,6R)-3-hydroxy-2-(hydroxymethyl)-3,6-dihydro-2H-pyran-6-yl]hex-3-enoate (PubChem CID 16758353) has the molecular formula C13H20O5 and a molecular weight of 256.30 g/mol. Its IUPAC name is methyl (Z,5R)-5-[(2R,3S,6R)-3-hydroxy-2-(hydroxymethyl)-3,6-dihydro-2H-pyran-6-yl]hex-3-enoate.
| Compound Name | methyl (Z,5R)-5-[(2R,3S,6R)-3-hydroxy-2-(hydroxymethyl)-3,6-dihydro-2H-pyran-6-yl]hex-3-enoate |
|---|---|
| PubChem CID | 16758353 |
| Molecular Formula | C13H20O5 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | methyl (Z,5R)-5-[(2R,3S,6R)-3-hydroxy-2-(hydroxymethyl)-3,6-dihydro-2H-pyran-6-yl]hex-3-enoate |
| SMILES | COC(=O)C/C=C\[C@@H](C)[C@H]1C=C[C@H](O)[C@@H](CO)O1 |
| InChI | InChI=1S/C13H20O5/c1-9(4-3-5-13(16)17-2)11-7-6-10(15)12(8-14)18-11/h3-4,6-7,9-12,14-15H,5,8H2,1-2H3/b4-3-/t9-,10+,11-,12-/m1/s1 |
| InChIKey | XOKIWDFQUVKLOL-YRNUAIPISA-N |
| XLogP | 0.42 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|