C17H24O7 — CID 16758354
methyl (Z,5R)-5-[(2S,3S,6S)-3-acetyloxy-2-(acetyloxymethyl)-3,6-dihydro-2H-pyran-6-yl]hex-3-enoate (PubChem CID 16758354) has the molecular formula C17H24O7 and a molecular weight of 340.37 g/mol. Its IUPAC name is methyl (Z,5R)-5-[(2S,3S,6S)-3-acetyloxy-2-(acetyloxymethyl)-3,6-dihydro-2H-pyran-6-yl]hex-3-enoate.
| Compound Name | methyl (Z,5R)-5-[(2S,3S,6S)-3-acetyloxy-2-(acetyloxymethyl)-3,6-dihydro-2H-pyran-6-yl]hex-3-enoate |
|---|---|
| PubChem CID | 16758354 |
| Molecular Formula | C17H24O7 |
| Molecular Weight | 340.37 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | methyl (Z,5R)-5-[(2S,3S,6S)-3-acetyloxy-2-(acetyloxymethyl)-3,6-dihydro-2H-pyran-6-yl]hex-3-enoate |
| SMILES | COC(=O)C/C=C\[C@@H](C)[C@@H]1C=C[C@H](OC(C)=O)[C@H](COC(C)=O)O1 |
| InChI | InChI=1S/C17H24O7/c1-11(6-5-7-17(20)21-4)14-8-9-15(23-13(3)19)16(24-14)10-22-12(2)18/h5-6,8-9,11,14-16H,7,10H2,1-4H3/b6-5-/t11-,14+,15+,16+/m1/s1 |
| InChIKey | YLSCUAOVAFPKBV-OTUPLLGVSA-N |
| XLogP | 1.56 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.37 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|