About methyl N-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]ethanimidothioate
methyl N-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]ethanimidothioate (PubChem CID 167583574) has the molecular formula C11H10ClN3OS
and a molecular weight of 267.74 g/mol. Its IUPAC name is methyl N-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]ethanimidothioate.
Molecular Properties
| Compound Name | methyl N-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]ethanimidothioate |
| PubChem CID | 167583574 |
| Molecular Formula | C11H10ClN3OS |
| Molecular Weight | 267.74 g/mol |
| Exact Mass | 267.02 |
| IUPAC Name | methyl N-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]ethanimidothioate |
| SMILES | CSC(C)=Nc1nnc(-c2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C11H10ClN3OS/c1-7(17-2)13-11-15-14-10(16-11)8-3-5-9(12)6-4-8/h3-6H,1-2H3 |
| InChIKey | HXTODAAYEWQEBT-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 51.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.74 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl N-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]ethanimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]ethanimidothioate?
The IUPAC name of methyl N-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]ethanimidothioate (CID 167583574) is methyl N-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]ethanimidothioate.
What is the SMILES notation for methyl N-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]ethanimidothioate?
The canonical SMILES for methyl N-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]ethanimidothioate is CSC(C)=Nc1nnc(-c2ccc(Cl)cc2)o1.
What is the InChIKey of methyl N-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]ethanimidothioate?
The InChIKey is HXTODAAYEWQEBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10ClN3OS/c1-7(17-2)13-11-15-14-10(16-11)8-3-5-9(12)6-4-8/h3-6H,1-2H3.
What are the key properties of methyl N-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]ethanimidothioate?
methyl N-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]ethanimidothioate has a molecular weight of 267.74 g/mol, XLogP of 3.80, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]ethanimidothioate is sourced from PubChem (CID 167583574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).