C15H27NO5S — CID 16758358
methyl (2S)-2-[[(Z,5R,6S)-7-hydroxy-6-methoxy-5-methylhept-3-enoyl]amino]-4-methylsulfanylbutanoate (PubChem CID 16758358) has the molecular formula C15H27NO5S and a molecular weight of 333.45 g/mol. Its IUPAC name is methyl (2S)-2-[[(Z,5R,6S)-7-hydroxy-6-methoxy-5-methylhept-3-enoyl]amino]-4-methylsulfanylbutanoate.
| Compound Name | methyl (2S)-2-[[(Z,5R,6S)-7-hydroxy-6-methoxy-5-methylhept-3-enoyl]amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 16758358 |
| Molecular Formula | C15H27NO5S |
| Molecular Weight | 333.45 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | methyl (2S)-2-[[(Z,5R,6S)-7-hydroxy-6-methoxy-5-methylhept-3-enoyl]amino]-4-methylsulfanylbutanoate |
| SMILES | COC(=O)[C@H](CCSC)NC(=O)C/C=C\[C@@H](C)[C@@H](CO)OC |
| InChI | InChI=1S/C15H27NO5S/c1-11(13(10-17)20-2)6-5-7-14(18)16-12(8-9-22-4)15(19)21-3/h5-6,11-13,17H,7-10H2,1-4H3,(H,16,18)/b6-5-/t11-,12+,13-/m1/s1 |
| InChIKey | DFDWCNWYFBIXGM-BDTQGIJQSA-N |
| XLogP | 0.99 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.45 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|