C26H37NO7 — CID 16758404
[(2S,3S,6R)-3-acetyloxy-6-[(2Z)-2-[(2R,3R)-2,4-dimethyl-3-phenylmethoxypentoxy]iminoethyl]-3,6-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 16758404) has the molecular formula C26H37NO7 and a molecular weight of 475.58 g/mol. Its IUPAC name is [(2S,3S,6R)-3-acetyloxy-6-[(2Z)-2-[(2R,3R)-2,4-dimethyl-3-phenylmethoxypentoxy]iminoethyl]-3,6-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [(2S,3S,6R)-3-acetyloxy-6-[(2Z)-2-[(2R,3R)-2,4-dimethyl-3-phenylmethoxypentoxy]iminoethyl]-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 16758404 |
| Molecular Formula | C26H37NO7 |
| Molecular Weight | 475.58 g/mol |
| Exact Mass | 475.26 |
| IUPAC Name | [(2S,3S,6R)-3-acetyloxy-6-[(2Z)-2-[(2R,3R)-2,4-dimethyl-3-phenylmethoxypentoxy]iminoethyl]-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1O[C@H](C/C=N\OC[C@@H](C)[C@H](OCc2ccccc2)C(C)C)C=C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C26H37NO7/c1-18(2)26(31-16-22-9-7-6-8-10-22)19(3)15-32-27-14-13-23-11-12-24(33-21(5)29)25(34-23)17-30-20(4)28/h6-12,14,18-19,23-26H,13,15-17H2,1-5H3/b27-14-/t19-,23+,24+,25+,26-/m1/s1 |
| InChIKey | VUZVOPBXGXQFAY-QQCMELMISA-N |
| XLogP | 4.07 |
| TPSA | 92.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.58 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|